About 8-(4-fluorophenyl)-2,4-dimethoxyquinoline
8-(4-fluorophenyl)-2,4-dimethoxyquinoline (PubChem CID 70166715) has the molecular formula C17H14FNO2
and a molecular weight of 283.30 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-2,4-dimethoxyquinoline.
Molecular Properties
| Compound Name | 8-(4-fluorophenyl)-2,4-dimethoxyquinoline |
| PubChem CID | 70166715 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 8-(4-fluorophenyl)-2,4-dimethoxyquinoline |
| SMILES | COc1cc(OC)c2cccc(-c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C17H14FNO2/c1-20-15-10-16(21-2)19-17-13(4-3-5-14(15)17)11-6-8-12(18)9-7-11/h3-10H,1-2H3 |
| InChIKey | KNELJEGYEYLFGZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(4-fluorophenyl)-2,4-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-fluorophenyl)-2,4-dimethoxyquinoline?
The IUPAC name of 8-(4-fluorophenyl)-2,4-dimethoxyquinoline (CID 70166715) is 8-(4-fluorophenyl)-2,4-dimethoxyquinoline.
What is the SMILES notation for 8-(4-fluorophenyl)-2,4-dimethoxyquinoline?
The canonical SMILES for 8-(4-fluorophenyl)-2,4-dimethoxyquinoline is COc1cc(OC)c2cccc(-c3ccc(F)cc3)c2n1.
What is the InChIKey of 8-(4-fluorophenyl)-2,4-dimethoxyquinoline?
The InChIKey is KNELJEGYEYLFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FNO2/c1-20-15-10-16(21-2)19-17-13(4-3-5-14(15)17)11-6-8-12(18)9-7-11/h3-10H,1-2H3.
What are the key properties of 8-(4-fluorophenyl)-2,4-dimethoxyquinoline?
8-(4-fluorophenyl)-2,4-dimethoxyquinoline has a molecular weight of 283.30 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-fluorophenyl)-2,4-dimethoxyquinoline is sourced from PubChem (CID 70166715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).