About 8,9-dihydro-4H-fluorene-1,5-dione
8,9-dihydro-4H-fluorene-1,5-dione (PubChem CID 70167038) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 8,9-dihydro-4H-fluorene-1,5-dione.
Molecular Properties
| Compound Name | 8,9-dihydro-4H-fluorene-1,5-dione |
| PubChem CID | 70167038 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 8,9-dihydro-4H-fluorene-1,5-dione |
| SMILES | O=C1C=CCC2=C1CC1=C2C(=O)C=CC1 |
| InChI | InChI=1S/C13H10O2/c14-11-5-2-4-9-10(11)7-8-3-1-6-12(15)13(8)9/h1-2,5-6H,3-4,7H2 |
| InChIKey | CWPJISLICBZPMB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,9-dihydro-4H-fluorene-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-4H-fluorene-1,5-dione?
The IUPAC name of 8,9-dihydro-4H-fluorene-1,5-dione (CID 70167038) is 8,9-dihydro-4H-fluorene-1,5-dione.
What is the SMILES notation for 8,9-dihydro-4H-fluorene-1,5-dione?
The canonical SMILES for 8,9-dihydro-4H-fluorene-1,5-dione is O=C1C=CCC2=C1CC1=C2C(=O)C=CC1.
What is the InChIKey of 8,9-dihydro-4H-fluorene-1,5-dione?
The InChIKey is CWPJISLICBZPMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-11-5-2-4-9-10(11)7-8-3-1-6-12(15)13(8)9/h1-2,5-6H,3-4,7H2.
What are the key properties of 8,9-dihydro-4H-fluorene-1,5-dione?
8,9-dihydro-4H-fluorene-1,5-dione has a molecular weight of 198.22 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-4H-fluorene-1,5-dione is sourced from PubChem (CID 70167038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).