C35H56O5 — CID 70167152
bis(3,7-dimethyloct-6-enyl) 2-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]propanedioate (PubChem CID 70167152) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is bis(3,7-dimethyloct-6-enyl) 2-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]propanedioate.
| Compound Name | bis(3,7-dimethyloct-6-enyl) 2-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]propanedioate |
|---|---|
| PubChem CID | 70167152 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | bis(3,7-dimethyloct-6-enyl) 2-[3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]propanedioate |
| SMILES | CC(C)=CCCC(C)CCOC(=O)C(C(=O)C=CC1=C(C)CCCC1(C)C)C(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C35H56O5/c1-25(2)13-10-15-27(5)20-23-39-33(37)32(34(38)40-24-21-28(6)16-11-14-26(3)4)31(36)19-18-30-29(7)17-12-22-35(30,8)9/h13-14,18-19,27-28,32H,10-12,15-17,20-24H2,1-9H3 |
| InChIKey | KVZZNHGFUHNANT-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|