C16H30Cl2 — CID 70168091
(2S)-1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decamethylcyclohexane (PubChem CID 70168091) has the molecular formula C16H30Cl2 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2S)-1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decamethylcyclohexane.
| Compound Name | (2S)-1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decamethylcyclohexane |
|---|---|
| PubChem CID | 70168091 |
| Molecular Formula | C16H30Cl2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (2S)-1,2-dichloro-1,2,3,3,4,4,5,5,6,6-decamethylcyclohexane |
| SMILES | CC1(C)C(C)(C)C(C)(C)[C@](C)(Cl)C(C)(Cl)C1(C)C |
| InChI | InChI=1S/C16H30Cl2/c1-11(2)12(3,4)14(7,8)16(10,18)15(9,17)13(11,5)6/h1-10H3/t15-,16?/m0/s1 |
| InChIKey | NDEJQLSQXPUBGG-VYRBHSGPSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|