C23H27N3O — CID 70168149
3-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 70168149) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 70168149 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-[3-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1cccc(-c2n[nH]c3c2Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C23H27N3O/c1-3-26(4-2)13-8-14-27-19-11-7-10-18(15-19)22-21-16-17-9-5-6-12-20(17)23(21)25-24-22/h5-7,9-12,15H,3-4,8,13-14,16H2,1-2H3,(H,24,25) |
| InChIKey | VRNSIXYPWGAWPD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|