About 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium
1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium (PubChem CID 7016843) has the molecular formula C9H20N2O2+2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium |
| PubChem CID | 7016843 |
| Molecular Formula | C9H20N2O2+2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium |
| SMILES | C1C[NH+](CCC2OCCO2)CC[NH2+]1 |
| InChI | InChI=1S/C9H18N2O2/c1(9-12-7-8-13-9)4-11-5-2-10-3-6-11/h9-10H,1-8H2/p+2 |
| InChIKey | ZRYJPBASNVAHTC-UHFFFAOYSA-P |
| XLogP | -2.79 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium?
The IUPAC name of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium (CID 7016843) is 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium.
What is the SMILES notation for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium?
The canonical SMILES for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium is C1C[NH+](CCC2OCCO2)CC[NH2+]1.
What is the InChIKey of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium?
The InChIKey is ZRYJPBASNVAHTC-UHFFFAOYSA-P. The full InChI is InChI=1S/C9H18N2O2/c1(9-12-7-8-13-9)4-11-5-2-10-3-6-11/h9-10H,1-8H2/p+2.
What are the key properties of 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium?
1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium has a molecular weight of 188.27 g/mol, XLogP of -2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dioxolan-2-yl)ethyl]piperazine-1,4-diium is sourced from PubChem (CID 7016843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).