About 7-bromo-[1,3]dioxolo[4,5-b]pyridine
7-bromo-[1,3]dioxolo[4,5-b]pyridine (PubChem CID 70168455) has the molecular formula C6H4BrNO2
and a molecular weight of 202.01 g/mol. Its IUPAC name is 7-bromo-[1,3]dioxolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 7-bromo-[1,3]dioxolo[4,5-b]pyridine |
| PubChem CID | 70168455 |
| Molecular Formula | C6H4BrNO2 |
| Molecular Weight | 202.01 g/mol |
| Exact Mass | 200.94 |
| IUPAC Name | 7-bromo-[1,3]dioxolo[4,5-b]pyridine |
| SMILES | Brc1ccnc2c1OCO2 |
| InChI | InChI=1S/C6H4BrNO2/c7-4-1-2-8-6-5(4)9-3-10-6/h1-2H,3H2 |
| InChIKey | VITHYEBBFYQSIT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.01 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-[1,3]dioxolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-[1,3]dioxolo[4,5-b]pyridine?
The IUPAC name of 7-bromo-[1,3]dioxolo[4,5-b]pyridine (CID 70168455) is 7-bromo-[1,3]dioxolo[4,5-b]pyridine.
What is the SMILES notation for 7-bromo-[1,3]dioxolo[4,5-b]pyridine?
The canonical SMILES for 7-bromo-[1,3]dioxolo[4,5-b]pyridine is Brc1ccnc2c1OCO2.
What is the InChIKey of 7-bromo-[1,3]dioxolo[4,5-b]pyridine?
The InChIKey is VITHYEBBFYQSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO2/c7-4-1-2-8-6-5(4)9-3-10-6/h1-2H,3H2.
What are the key properties of 7-bromo-[1,3]dioxolo[4,5-b]pyridine?
7-bromo-[1,3]dioxolo[4,5-b]pyridine has a molecular weight of 202.01 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-[1,3]dioxolo[4,5-b]pyridine is sourced from PubChem (CID 70168455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).