C20H22FN5O — CID 70168482
(6R)-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene (PubChem CID 70168482) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is (6R)-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene.
| Compound Name | (6R)-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene |
|---|---|
| PubChem CID | 70168482 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (6R)-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene |
| SMILES | Fc1ccc2c(c1)[C@H]1CCCN1c1ccn3ncc(c3n1)CNCCCO2 |
| InChI | InChI=1S/C20H22FN5O/c21-15-4-5-18-16(11-15)17-3-1-8-25(17)19-6-9-26-20(24-19)14(13-23-26)12-22-7-2-10-27-18/h4-6,9,11,13,17,22H,1-3,7-8,10,12H2/t17-/m1/s1 |
| InChIKey | OAERZRAEDKYULV-QGZVFWFLSA-N |
| XLogP | 3.08 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |