About 1-bromo-4-pentoxybenzene
1-bromo-4-pentoxybenzene (PubChem CID 7016905) has the molecular formula C11H15BrO
and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-bromo-4-pentoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-pentoxybenzene |
| PubChem CID | 7016905 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-bromo-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H15BrO/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8H,2-4,9H2,1H3 |
| InChIKey | ILLQRHZDICIFRQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-pentoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-pentoxybenzene?
The IUPAC name of 1-bromo-4-pentoxybenzene (CID 7016905) is 1-bromo-4-pentoxybenzene.
What is the SMILES notation for 1-bromo-4-pentoxybenzene?
The canonical SMILES for 1-bromo-4-pentoxybenzene is CCCCCOc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-pentoxybenzene?
The InChIKey is ILLQRHZDICIFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8H,2-4,9H2,1H3.
What are the key properties of 1-bromo-4-pentoxybenzene?
1-bromo-4-pentoxybenzene has a molecular weight of 243.14 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-pentoxybenzene is sourced from PubChem (CID 7016905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).