C17H20BF2NO3S — CID 70170320
3-[(2,2-difluorocyclopropyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one (PubChem CID 70170320) has the molecular formula C17H20BF2NO3S and a molecular weight of 367.23 g/mol. Its IUPAC name is 3-[(2,2-difluorocyclopropyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one.
| Compound Name | 3-[(2,2-difluorocyclopropyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 70170320 |
| Molecular Formula | C17H20BF2NO3S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[(2,2-difluorocyclopropyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)sc(=O)n3CC2CC2(F)F)OC1(C)C |
| InChI | InChI=1S/C17H20BF2NO3S/c1-15(2)16(3,4)24-18(23-15)11-5-6-12-13(7-11)25-14(22)21(12)9-10-8-17(10,19)20/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | VAQJNYKQLXPAMI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|