C14H27FO4Si — CID 70170361
[(2R,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methyloxan-4-yl] acetate (PubChem CID 70170361) has the molecular formula C14H27FO4Si and a molecular weight of 306.45 g/mol. Its IUPAC name is [(2R,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 70170361 |
| Molecular Formula | C14H27FO4Si |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(2R,3S,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methyloxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)O[C@H](C)[C@@H]1F |
| InChI | InChI=1S/C14H27FO4Si/c1-9-13(15)11(18-10(2)16)8-12(17-9)19-20(6,7)14(3,4)5/h9,11-13H,8H2,1-7H3/t9-,11-,12-,13+/m1/s1 |
| InChIKey | QGUBAXKOUZBKTQ-JHEVNIALSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|