C24H35F3N4O11 — CID 70170406
2,8-difluoro-1-[6-(2-fluoro-3,4-dihydroxybutyl)pyrazin-2-yl]-8-[6-(2,3,4-trihydroxybutyl)pyrazin-2-yl]octane-1,3,4,5,6,7-hexol (PubChem CID 70170406) has the molecular formula C24H35F3N4O11 and a molecular weight of 612.56 g/mol. Its IUPAC name is 2,8-difluoro-1-[6-(2-fluoro-3,4-dihydroxybutyl)pyrazin-2-yl]-8-[6-(2,3,4-trihydroxybutyl)pyrazin-2-yl]octane-1,3,4,5,6,7-hexol.
| Compound Name | 2,8-difluoro-1-[6-(2-fluoro-3,4-dihydroxybutyl)pyrazin-2-yl]-8-[6-(2,3,4-trihydroxybutyl)pyrazin-2-yl]octane-1,3,4,5,6,7-hexol |
|---|---|
| PubChem CID | 70170406 |
| Molecular Formula | C24H35F3N4O11 |
| Molecular Weight | 612.56 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 2,8-difluoro-1-[6-(2-fluoro-3,4-dihydroxybutyl)pyrazin-2-yl]-8-[6-(2,3,4-trihydroxybutyl)pyrazin-2-yl]octane-1,3,4,5,6,7-hexol |
| SMILES | OCC(O)C(O)Cc1cncc(C(F)C(O)C(O)C(O)C(O)C(O)C(F)C(O)c2cncc(CC(F)C(O)CO)n2)n1 |
| InChI | InChI=1S/C24H35F3N4O11/c25-11(15(35)7-32)1-9-3-29-6-13(31-9)19(37)18(27)21(39)23(41)24(42)22(40)20(38)17(26)12-5-28-4-10(30-12)2-14(34)16(36)8-33/h3-6,11,14-24,32-42H,1-2,7-8H2 |
| InChIKey | GJEVJRWSGGVIJS-UHFFFAOYSA-N |
| XLogP | -4.36 |
| TPSA | 274.09 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.56 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |