About [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate
[(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate (PubChem CID 70170668) has the molecular formula C11H18O5S
and a molecular weight of 262.33 g/mol. Its IUPAC name is [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate.
Molecular Properties
| Compound Name | [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate |
| PubChem CID | 70170668 |
| Molecular Formula | C11H18O5S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC(=O)[C@H]1CSCC(O)CO |
| InChI | InChI=1S/C11H18O5S/c1-7(13)16-11-3-2-10(15)9(11)6-17-5-8(14)4-12/h8-9,11-12,14H,2-6H2,1H3/t8?,9-,11-/m1/s1 |
| InChIKey | VRMBFTRZWHQKIV-HOGWDWRMSA-N |
| XLogP | -0.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate?
The IUPAC name of [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate (CID 70170668) is [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate.
What is the SMILES notation for [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate?
The canonical SMILES for [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate is CC(=O)O[C@@H]1CCC(=O)[C@H]1CSCC(O)CO.
What is the InChIKey of [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate?
The InChIKey is VRMBFTRZWHQKIV-HOGWDWRMSA-N. The full InChI is InChI=1S/C11H18O5S/c1-7(13)16-11-3-2-10(15)9(11)6-17-5-8(14)4-12/h8-9,11-12,14H,2-6H2,1H3/t8?,9-,11-/m1/s1.
What are the key properties of [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate?
[(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate has a molecular weight of 262.33 g/mol, XLogP of -0.02, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(2,3-dihydroxypropylsulfanylmethyl)-3-oxocyclopentyl] acetate is sourced from PubChem (CID 70170668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).