About 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine
2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine (PubChem CID 70170825) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine |
| PubChem CID | 70170825 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine |
| SMILES | CCCC1C=C(N)NN1c1ccccc1 |
| InChI | InChI=1S/C12H17N3/c1-2-6-11-9-12(13)14-15(11)10-7-4-3-5-8-10/h3-5,7-9,11,14H,2,6,13H2,1H3 |
| InChIKey | RBJILGXMMPZULL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine?
The IUPAC name of 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine (CID 70170825) is 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine.
What is the SMILES notation for 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine?
The canonical SMILES for 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine is CCCC1C=C(N)NN1c1ccccc1.
What is the InChIKey of 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine?
The InChIKey is RBJILGXMMPZULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3/c1-2-6-11-9-12(13)14-15(11)10-7-4-3-5-8-10/h3-5,7-9,11,14H,2,6,13H2,1H3.
What are the key properties of 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine?
2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine has a molecular weight of 203.29 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-propyl-1,3-dihydropyrazol-5-amine is sourced from PubChem (CID 70170825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).