C10H9Cl2F3N2 — CID 70171088
N'-(2,6-dichlorophenyl)-2,2,2-trifluoro-N,N-dimethylethanimidamide (PubChem CID 70171088) has the molecular formula C10H9Cl2F3N2 and a molecular weight of 285.10 g/mol. Its IUPAC name is N'-(2,6-dichlorophenyl)-2,2,2-trifluoro-N,N-dimethylethanimidamide.
| Compound Name | N'-(2,6-dichlorophenyl)-2,2,2-trifluoro-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 70171088 |
| Molecular Formula | C10H9Cl2F3N2 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | N'-(2,6-dichlorophenyl)-2,2,2-trifluoro-N,N-dimethylethanimidamide |
| SMILES | CN(C)/C(=N/c1c(Cl)cccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F3N2/c1-17(2)9(10(13,14)15)16-8-6(11)4-3-5-7(8)12/h3-5H,1-2H3/b16-9+ |
| InChIKey | HPTCEZNGRDXQKW-CXUHLZMHSA-N |
| XLogP | 4.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|