About 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid
2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid (PubChem CID 70171140) has the molecular formula C21H34O5
and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid |
| PubChem CID | 70171140 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(O)(C(C(=O)O)C(=O)OC1CCC2C=CC1CC2)C(C)(C)C |
| InChI | InChI=1S/C21H34O5/c1-19(2,3)21(25,20(4,5)6)16(17(22)23)18(24)26-15-12-9-13-7-10-14(15)11-8-13/h7,10,13-16,25H,8-9,11-12H2,1-6H3,(H,22,23) |
| InChIKey | KINATLLXJDTFKR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid?
The IUPAC name of 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid (CID 70171140) is 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid is CC(C)(C)C(O)(C(C(=O)O)C(=O)OC1CCC2C=CC1CC2)C(C)(C)C.
What is the InChIKey of 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid?
The InChIKey is KINATLLXJDTFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O5/c1-19(2,3)21(25,20(4,5)6)16(17(22)23)18(24)26-15-12-9-13-7-10-14(15)11-8-13/h7,10,13-16,25H,8-9,11-12H2,1-6H3,(H,22,23).
What are the key properties of 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid?
2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid has a molecular weight of 366.50 g/mol, XLogP of 3.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[3.2.2]non-6-enyloxycarbonyl)-3-tert-butyl-3-hydroxy-4,4-dimethylpentanoic acid is sourced from PubChem (CID 70171140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).