C20H22N2O4 — CID 70171233
(3aR,7aS)-6-methoxy-2-phenyl-4-(pyrrolidine-1-carbonyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 70171233) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3aR,7aS)-6-methoxy-2-phenyl-4-(pyrrolidine-1-carbonyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-6-methoxy-2-phenyl-4-(pyrrolidine-1-carbonyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 70171233 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3aR,7aS)-6-methoxy-2-phenyl-4-(pyrrolidine-1-carbonyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COC1=CC(C(=O)N2CCCC2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C20H22N2O4/c1-26-14-11-15(18(23)21-9-5-6-10-21)17-16(12-14)19(24)22(20(17)25)13-7-3-2-4-8-13/h2-4,7-8,11,15-17H,5-6,9-10,12H2,1H3/t15?,16-,17-/m0/s1 |
| InChIKey | MVENELPRWVXJMX-BSOSBYQFSA-N |
| XLogP | 1.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|