About 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene
1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 70171306) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 70171306 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | CC(C)(C)OC1C2C=CC(C)(O2)C1OC(C)(C)C |
| InChI | InChI=1S/C15H26O3/c1-13(2,3)17-11-10-8-9-15(7,16-10)12(11)18-14(4,5)6/h8-12H,1-7H3 |
| InChIKey | CWQKHMOHWRNOJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene?
The IUPAC name of 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene (CID 70171306) is 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene is CC(C)(C)OC1C2C=CC(C)(O2)C1OC(C)(C)C.
What is the InChIKey of 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene?
The InChIKey is CWQKHMOHWRNOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-13(2,3)17-11-10-8-9-15(7,16-10)12(11)18-14(4,5)6/h8-12H,1-7H3.
What are the key properties of 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene?
1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene has a molecular weight of 254.37 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]-7-oxabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 70171306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).