C27H28F3NOS — CID 70171459
4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol (PubChem CID 70171459) has the molecular formula C27H28F3NOS and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 70171459 |
| Molecular Formula | C27H28F3NOS |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-tert-butyl-2-(2-phenylpropan-2-yl)-6-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(C2Nc3cc(C(F)(F)F)ccc3S2)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C27H28F3NOS/c1-25(2,3)18-13-19(23(32)20(14-18)26(4,5)16-9-7-6-8-10-16)24-31-21-15-17(27(28,29)30)11-12-22(21)33-24/h6-15,24,31-32H,1-5H3 |
| InChIKey | CWBDLVGUMPKCGI-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|