C22H26F3NOS — CID 70171461
4-(2-methylheptan-2-yl)-2-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol (PubChem CID 70171461) has the molecular formula C22H26F3NOS and a molecular weight of 409.52 g/mol. Its IUPAC name is 4-(2-methylheptan-2-yl)-2-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 4-(2-methylheptan-2-yl)-2-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 70171461 |
| Molecular Formula | C22H26F3NOS |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-(2-methylheptan-2-yl)-2-[5-(trifluoromethyl)-2,3-dihydro-1,3-benzothiazol-2-yl]phenol |
| SMILES | CCCCCC(C)(C)c1ccc(O)c(C2Nc3cc(C(F)(F)F)ccc3S2)c1 |
| InChI | InChI=1S/C22H26F3NOS/c1-4-5-6-11-21(2,3)14-7-9-18(27)16(12-14)20-26-17-13-15(22(23,24)25)8-10-19(17)28-20/h7-10,12-13,20,26-27H,4-6,11H2,1-3H3 |
| InChIKey | VOLAARPWSMZKGY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|