C28H35N5O — CID 70172951
2-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-N-methyl-2-naphthalen-1-yl-N-phenylacetamide (PubChem CID 70172951) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-N-methyl-2-naphthalen-1-yl-N-phenylacetamide.
| Compound Name | 2-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-N-methyl-2-naphthalen-1-yl-N-phenylacetamide |
|---|---|
| PubChem CID | 70172951 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 2-[[4-[(diaminomethylideneamino)methyl]cyclohexyl]methylamino]-N-methyl-2-naphthalen-1-yl-N-phenylacetamide |
| SMILES | CN(C(=O)C(NCC1CCC(CN=C(N)N)CC1)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C28H35N5O/c1-33(23-10-3-2-4-11-23)27(34)26(25-13-7-9-22-8-5-6-12-24(22)25)31-18-20-14-16-21(17-15-20)19-32-28(29)30/h2-13,20-21,26,31H,14-19H2,1H3,(H4,29,30,32) |
| InChIKey | JXUCGBQHMXIUSP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|