About methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate
methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 7017606) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate |
| PubChem CID | 7017606 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate |
| SMILES | COC(=O)CCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C9H13BrN2O2/c1-6-9(10)7(2)12(11-6)5-4-8(13)14-3/h4-5H2,1-3H3 |
| InChIKey | ATDKDNJRUBWAGH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The IUPAC name of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate (CID 7017606) is methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate.
What is the SMILES notation for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The canonical SMILES for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate is COC(=O)CCn1nc(C)c(Br)c1C.
What is the InChIKey of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The InChIKey is ATDKDNJRUBWAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O2/c1-6-9(10)7(2)12(11-6)5-4-8(13)14-3/h4-5H2,1-3H3.
What are the key properties of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate has a molecular weight of 261.12 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate is sourced from PubChem (CID 7017606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).