methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate

C9H13BrN2O2 — CID 7017606

IUPACmethyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate
SMILESCOC(=O)CCn1nc(C)c(Br)c1C
InChIInChI=1S/C9H13BrN2O2/c1-6-9(10)7(2)12(11-6)5-4-8(13)14-3/h4-5H2,1-3H3
InChIKeyATDKDNJRUBWAGH-UHFFFAOYSA-N
MW261.12 g/mol
LogP1.83
Rot. Bonds3

About methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate

methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate (PubChem CID 7017606) has the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. Its IUPAC name is methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate
PubChem CID7017606
Molecular FormulaC9H13BrN2O2
Molecular Weight261.12 g/mol
Exact Mass260.02
IUPAC Namemethyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate
SMILESCOC(=O)CCn1nc(C)c(Br)c1C
InChIInChI=1S/C9H13BrN2O2/c1-6-9(10)7(2)12(11-6)5-4-8(13)14-3/h4-5H2,1-3H3
InChIKeyATDKDNJRUBWAGH-UHFFFAOYSA-N
XLogP1.83
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.12
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The IUPAC name of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate (CID 7017606) is methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate.
What is the SMILES notation for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The canonical SMILES for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate is COC(=O)CCn1nc(C)c(Br)c1C.
What is the InChIKey of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
The InChIKey is ATDKDNJRUBWAGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O2/c1-6-9(10)7(2)12(11-6)5-4-8(13)14-3/h4-5H2,1-3H3.
What are the key properties of methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate?
methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate has a molecular weight of 261.12 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoate is sourced from PubChem (CID 7017606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).