About 1-ethylpyrazol-4-ol
1-ethylpyrazol-4-ol (PubChem CID 7017620) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 1-ethylpyrazol-4-ol.
Molecular Properties
| Compound Name | 1-ethylpyrazol-4-ol |
| PubChem CID | 7017620 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 1-ethylpyrazol-4-ol |
| SMILES | CCn1cc(O)cn1 |
| InChI | InChI=1S/C5H8N2O/c1-2-7-4-5(8)3-6-7/h3-4,8H,2H2,1H3 |
| InChIKey | RWONCMDCEBQRLV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylpyrazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrazol-4-ol?
The IUPAC name of 1-ethylpyrazol-4-ol (CID 7017620) is 1-ethylpyrazol-4-ol.
What is the SMILES notation for 1-ethylpyrazol-4-ol?
The canonical SMILES for 1-ethylpyrazol-4-ol is CCn1cc(O)cn1.
What is the InChIKey of 1-ethylpyrazol-4-ol?
The InChIKey is RWONCMDCEBQRLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-2-7-4-5(8)3-6-7/h3-4,8H,2H2,1H3.
What are the key properties of 1-ethylpyrazol-4-ol?
1-ethylpyrazol-4-ol has a molecular weight of 112.13 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrazol-4-ol is sourced from PubChem (CID 7017620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).