C33H55FO3Si — CID 70178465
ethyl 2-[(7S,8R,9S,10R,13S,14S)-7-butyl-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate (PubChem CID 70178465) has the molecular formula C33H55FO3Si and a molecular weight of 546.88 g/mol. Its IUPAC name is ethyl 2-[(7S,8R,9S,10R,13S,14S)-7-butyl-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate.
| Compound Name | ethyl 2-[(7S,8R,9S,10R,13S,14S)-7-butyl-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate |
|---|---|
| PubChem CID | 70178465 |
| Molecular Formula | C33H55FO3Si |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | ethyl 2-[(7S,8R,9S,10R,13S,14S)-7-butyl-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-2-fluoroacetate |
| SMILES | CCCC[C@@H]1C=C2CC(O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]2CC[C@]3(C)C(=C(F)C(=O)OCC)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C33H55FO3Si/c1-10-12-13-22-20-23-21-24(37-38(8,9)31(3,4)5)16-18-32(23,6)26-17-19-33(7)25(28(22)26)14-15-27(33)29(34)30(35)36-11-2/h20,22,24-26,28H,10-19,21H2,1-9H3/t22-,24?,25+,26+,28+,32+,33+/m1/s1 |
| InChIKey | DYZOQULVBKGQHA-HHXRTOGKSA-N |
| XLogP | 9.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|