About 5-ethoxycyclohex-2-ene-1,4-dione
5-ethoxycyclohex-2-ene-1,4-dione (PubChem CID 70178664) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 5-ethoxycyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5-ethoxycyclohex-2-ene-1,4-dione |
| PubChem CID | 70178664 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5-ethoxycyclohex-2-ene-1,4-dione |
| SMILES | CCOC1CC(=O)C=CC1=O |
| InChI | InChI=1S/C8H10O3/c1-2-11-8-5-6(9)3-4-7(8)10/h3-4,8H,2,5H2,1H3 |
| InChIKey | JHIYJEMVQZGPDG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxycyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxycyclohex-2-ene-1,4-dione?
The IUPAC name of 5-ethoxycyclohex-2-ene-1,4-dione (CID 70178664) is 5-ethoxycyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5-ethoxycyclohex-2-ene-1,4-dione?
The canonical SMILES for 5-ethoxycyclohex-2-ene-1,4-dione is CCOC1CC(=O)C=CC1=O.
What is the InChIKey of 5-ethoxycyclohex-2-ene-1,4-dione?
The InChIKey is JHIYJEMVQZGPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-2-11-8-5-6(9)3-4-7(8)10/h3-4,8H,2,5H2,1H3.
What are the key properties of 5-ethoxycyclohex-2-ene-1,4-dione?
5-ethoxycyclohex-2-ene-1,4-dione has a molecular weight of 154.16 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxycyclohex-2-ene-1,4-dione is sourced from PubChem (CID 70178664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).