C28H38N6O3S — CID 70178684
3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-(methanesulfonamido)-3-oxoquinoxalin-2-yl]benzenecarboximidamide (PubChem CID 70178684) has the molecular formula C28H38N6O3S and a molecular weight of 538.72 g/mol. Its IUPAC name is 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-(methanesulfonamido)-3-oxoquinoxalin-2-yl]benzenecarboximidamide.
| Compound Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-(methanesulfonamido)-3-oxoquinoxalin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70178684 |
| Molecular Formula | C28H38N6O3S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 3-[4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-6-(methanesulfonamido)-3-oxoquinoxalin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2nc3ccc(NS(C)(=O)=O)cc3n(CCCCCN3[C@H](C)CCC[C@@H]3C)c2=O)c1 |
| InChI | InChI=1S/C28H38N6O3S/c1-19-9-7-10-20(2)33(19)15-5-4-6-16-34-25-18-23(32-38(3,36)37)13-14-24(25)31-26(28(34)35)21-11-8-12-22(17-21)27(29)30/h8,11-14,17-20,32H,4-7,9-10,15-16H2,1-3H3,(H3,29,30)/t19-,20+ |
| InChIKey | KXEDFZYEOJHBBS-BGYRXZFFSA-N |
| XLogP | 4.15 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|