C19H16O4 — CID 70178818
methyl (12R)-12-hydroxy-16-oxo-11,12,15,17-tetrahydrocyclopenta[a]phenanthrene-15-carboxylate (PubChem CID 70178818) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (12R)-12-hydroxy-16-oxo-11,12,15,17-tetrahydrocyclopenta[a]phenanthrene-15-carboxylate.
| Compound Name | methyl (12R)-12-hydroxy-16-oxo-11,12,15,17-tetrahydrocyclopenta[a]phenanthrene-15-carboxylate |
|---|---|
| PubChem CID | 70178818 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | methyl (12R)-12-hydroxy-16-oxo-11,12,15,17-tetrahydrocyclopenta[a]phenanthrene-15-carboxylate |
| SMILES | COC(=O)C1C(=O)CC2=C1c1ccc3ccccc3c1C[C@H]2O |
| InChI | InChI=1S/C19H16O4/c1-23-19(22)18-16(21)9-14-15(20)8-13-11-5-3-2-4-10(11)6-7-12(13)17(14)18/h2-7,15,18,20H,8-9H2,1H3/t15-,18?/m1/s1 |
| InChIKey | FNGMRZLCINLZGI-NNJIEVJOSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|