About 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline
1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline (PubChem CID 70178904) has the molecular formula C25H33N3O2
and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline.
Molecular Properties
| Compound Name | 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline |
| PubChem CID | 70178904 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline |
| SMILES | CC(C)(C)c1cc(C(=O)O)n(Cc2ccccc2)n1.CC(C)(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H18N2O2.C10H15N/c1-15(2,3)13-9-12(14(18)19)17(16-13)10-11-7-5-4-6-8-11;1-10(2,3)8-4-6-9(11)7-5-8/h4-9H,10H2,1-3H3,(H,18,19);4-7H,11H2,1-3H3 |
| InChIKey | QENHXIOBUWUONQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline?
The IUPAC name of 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline (CID 70178904) is 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline.
What is the SMILES notation for 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline?
The canonical SMILES for 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline is CC(C)(C)c1cc(C(=O)O)n(Cc2ccccc2)n1.CC(C)(C)c1ccc(N)cc1.
What is the InChIKey of 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline?
The InChIKey is QENHXIOBUWUONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.C10H15N/c1-15(2,3)13-9-12(14(18)19)17(16-13)10-11-7-5-4-6-8-11;1-10(2,3)8-4-6-9(11)7-5-8/h4-9H,10H2,1-3H3,(H,18,19);4-7H,11H2,1-3H3.
What are the key properties of 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline?
1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline has a molecular weight of 407.56 g/mol, XLogP of 5.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-tert-butylpyrazole-5-carboxylic acid;4-tert-butylaniline is sourced from PubChem (CID 70178904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).