C13H13BrN2O — CID 70178928
6-amino-1-(3-bromophenyl)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 70178928) has the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. Its IUPAC name is 6-amino-1-(3-bromophenyl)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-amino-1-(3-bromophenyl)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 70178928 |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 6-amino-1-(3-bromophenyl)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1(c2cccc(Br)c2)C=CC=CC1N |
| InChI | InChI=1S/C13H13BrN2O/c14-10-5-3-4-9(8-10)13(12(16)17)7-2-1-6-11(13)15/h1-8,11H,15H2,(H2,16,17) |
| InChIKey | XYMIHEIMPBYNDV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |