About 2-ethyl-1-methyl-2,7-dihydropurine
2-ethyl-1-methyl-2,7-dihydropurine (PubChem CID 70179017) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-ethyl-1-methyl-2,7-dihydropurine.
Molecular Properties
| Compound Name | 2-ethyl-1-methyl-2,7-dihydropurine |
| PubChem CID | 70179017 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-ethyl-1-methyl-2,7-dihydropurine |
| SMILES | CCC1N=c2nc[nH]c2=CN1C |
| InChI | InChI=1S/C8H12N4/c1-3-7-11-8-6(4-12(7)2)9-5-10-8/h4-5,7H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | YFWVRHDUJZBVNH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1-methyl-2,7-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-methyl-2,7-dihydropurine?
The IUPAC name of 2-ethyl-1-methyl-2,7-dihydropurine (CID 70179017) is 2-ethyl-1-methyl-2,7-dihydropurine.
What is the SMILES notation for 2-ethyl-1-methyl-2,7-dihydropurine?
The canonical SMILES for 2-ethyl-1-methyl-2,7-dihydropurine is CCC1N=c2nc[nH]c2=CN1C.
What is the InChIKey of 2-ethyl-1-methyl-2,7-dihydropurine?
The InChIKey is YFWVRHDUJZBVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-3-7-11-8-6(4-12(7)2)9-5-10-8/h4-5,7H,3H2,1-2H3,(H,9,10,11).
What are the key properties of 2-ethyl-1-methyl-2,7-dihydropurine?
2-ethyl-1-methyl-2,7-dihydropurine has a molecular weight of 164.21 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-methyl-2,7-dihydropurine is sourced from PubChem (CID 70179017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).