About methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane
methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane (PubChem CID 70179871) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane.
Molecular Properties
| Compound Name | methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane |
| PubChem CID | 70179871 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane |
| SMILES | C=CCOCCC.COC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C6H9NO3.C6H12O/c1-10-6(9)4-2-5(8)7-3-4;1-3-5-7-6-4-2/h4H,2-3H2,1H3,(H,7,8);3H,1,4-6H2,2H3 |
| InChIKey | CBHMWJNFPQPRNJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane?
The IUPAC name of methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane (CID 70179871) is methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane.
What is the SMILES notation for methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane?
The canonical SMILES for methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane is C=CCOCCC.COC(=O)C1CNC(=O)C1.
What is the InChIKey of methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane?
The InChIKey is CBHMWJNFPQPRNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.C6H12O/c1-10-6(9)4-2-5(8)7-3-4;1-3-5-7-6-4-2/h4H,2-3H2,1H3,(H,7,8);3H,1,4-6H2,2H3.
What are the key properties of methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane?
methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane has a molecular weight of 243.30 g/mol, XLogP of 0.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxopyrrolidine-3-carboxylate;1-prop-2-enoxypropane is sourced from PubChem (CID 70179871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).