C8H11NO6 — CID 70180672
2-(carboxymethylamino)-2-cyclopropylpropanedioic acid (PubChem CID 70180672) has the molecular formula C8H11NO6 and a molecular weight of 217.18 g/mol. Its IUPAC name is 2-(carboxymethylamino)-2-cyclopropylpropanedioic acid.
| Compound Name | 2-(carboxymethylamino)-2-cyclopropylpropanedioic acid |
|---|---|
| PubChem CID | 70180672 |
| Molecular Formula | C8H11NO6 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-(carboxymethylamino)-2-cyclopropylpropanedioic acid |
| SMILES | O=C(O)CNC(C(=O)O)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C8H11NO6/c10-5(11)3-9-8(6(12)13,7(14)15)4-1-2-4/h4,9H,1-3H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | ZAGGDDZSAZGRDS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|