About CID 70180959
CID 70180959 (PubChem CID 70180959) has the molecular formula C30H35O6Si
and a molecular weight of 519.69 g/mol.
Molecular Properties
| Compound Name | CID 70180959 |
| PubChem CID | 70180959 |
| Molecular Formula | C30H35O6Si |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | — |
| SMILES | COC(=O)COc1ccc(O[Si](c2ccccc2)c2ccccc2)c(C(C)(C)C)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H35O6Si/c1-29(2,3)27-24(36-37(21-14-10-8-11-15-21)22-16-12-9-13-17-22)19-18-23(34-20-25(31)33-7)26(27)28(32)35-30(4,5)6/h8-19H,20H2,1-7H3 |
| InChIKey | NOLGCFYAYJNHMU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70180959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70180959?
The IUPAC name of CID 70180959 (CID 70180959) is not available.
What is the SMILES notation for CID 70180959?
The canonical SMILES for CID 70180959 is COC(=O)COc1ccc(O[Si](c2ccccc2)c2ccccc2)c(C(C)(C)C)c1C(=O)OC(C)(C)C.
What is the InChIKey of CID 70180959?
The InChIKey is NOLGCFYAYJNHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35O6Si/c1-29(2,3)27-24(36-37(21-14-10-8-11-15-21)22-16-12-9-13-17-22)19-18-23(34-20-25(31)33-7)26(27)28(32)35-30(4,5)6/h8-19H,20H2,1-7H3.
What are the key properties of CID 70180959?
CID 70180959 has a molecular weight of 519.69 g/mol, XLogP of 4.68, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70180959 is sourced from PubChem (CID 70180959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).