C10H20N4S — CID 70181217
2-methylsulfanyl-4,6-di(propan-2-yl)-2H-1,3,5-triazin-1-amine (PubChem CID 70181217) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-methylsulfanyl-4,6-di(propan-2-yl)-2H-1,3,5-triazin-1-amine.
| Compound Name | 2-methylsulfanyl-4,6-di(propan-2-yl)-2H-1,3,5-triazin-1-amine |
|---|---|
| PubChem CID | 70181217 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-methylsulfanyl-4,6-di(propan-2-yl)-2H-1,3,5-triazin-1-amine |
| SMILES | CSC1N=C(C(C)C)N=C(C(C)C)N1N |
| InChI | InChI=1S/C10H20N4S/c1-6(2)8-12-9(7(3)4)14(11)10(13-8)15-5/h6-7,10H,11H2,1-5H3 |
| InChIKey | ITUJTNVTYSHLGM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|