About N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide
N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide (PubChem CID 70181244) has the molecular formula C11H18N3O+
and a molecular weight of 208.28 g/mol. Its IUPAC name is N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide |
| PubChem CID | 70181244 |
| Molecular Formula | C11H18N3O+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide |
| SMILES | C=CC[N+]1(CCNC(=O)C=C)C=NCC1 |
| InChI | InChI=1S/C11H17N3O/c1-3-7-14(8-5-12-10-14)9-6-13-11(15)4-2/h3-4,10H,1-2,5-9H2/p+1 |
| InChIKey | ZCLGFAYHPKXMIT-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide?
The IUPAC name of N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide (CID 70181244) is N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide?
The canonical SMILES for N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide is C=CC[N+]1(CCNC(=O)C=C)C=NCC1.
What is the InChIKey of N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide?
The InChIKey is ZCLGFAYHPKXMIT-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H17N3O/c1-3-7-14(8-5-12-10-14)9-6-13-11(15)4-2/h3-4,10H,1-2,5-9H2/p+1.
What are the key properties of N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide?
N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide has a molecular weight of 208.28 g/mol, XLogP of 0.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-prop-2-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]prop-2-enamide is sourced from PubChem (CID 70181244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).