C24H37NO3 — CID 70181467
3-(2-butan-2-yl-3,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-methoxy-5-methyl-1H-pyrrol-2-one (PubChem CID 70181467) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is 3-(2-butan-2-yl-3,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-methoxy-5-methyl-1H-pyrrol-2-one.
| Compound Name | 3-(2-butan-2-yl-3,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-methoxy-5-methyl-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 70181467 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 3-(2-butan-2-yl-3,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl)-5-methoxy-5-methyl-1H-pyrrol-2-one |
| SMILES | CCC(C)C1C(C)=CC2CC(C)CC(C)C2C1C(=O)C1=CC(C)(OC)NC1=O |
| InChI | InChI=1S/C24H37NO3/c1-8-14(3)19-16(5)11-17-10-13(2)9-15(4)20(17)21(19)22(26)18-12-24(6,28-7)25-23(18)27/h11-15,17,19-21H,8-10H2,1-7H3,(H,25,27) |
| InChIKey | OJBFFIMQDZDJAK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|