C26H56N4S4 — CID 70181811
1,4,8,11-tetrakis(2-ethylsulfanylethyl)-1,4,8,11-tetrazacyclotetradecane (PubChem CID 70181811) has the molecular formula C26H56N4S4 and a molecular weight of 553.03 g/mol. Its IUPAC name is 1,4,8,11-tetrakis(2-ethylsulfanylethyl)-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1,4,8,11-tetrakis(2-ethylsulfanylethyl)-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 70181811 |
| Molecular Formula | C26H56N4S4 |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | 1,4,8,11-tetrakis(2-ethylsulfanylethyl)-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CCSCCN1CCCN(CCSCC)CCN(CCSCC)CCCN(CCSCC)CC1 |
| InChI | InChI=1S/C26H56N4S4/c1-5-31-23-19-27-11-9-12-29(21-25-33-7-3)17-18-30(22-26-34-8-4)14-10-13-28(16-15-27)20-24-32-6-2/h5-26H2,1-4H3 |
| InChIKey | KZRKBTBCFMMLNL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|