About 4-bromo-3-chlorophenol
4-bromo-3-chlorophenol (PubChem CID 7018182) has the molecular formula C6H4BrClO
and a molecular weight of 207.45 g/mol. Its IUPAC name is 4-bromo-3-chlorophenol.
Molecular Properties
| Compound Name | 4-bromo-3-chlorophenol |
| PubChem CID | 7018182 |
| Molecular Formula | C6H4BrClO |
| Molecular Weight | 207.45 g/mol |
| Exact Mass | 205.91 |
| IUPAC Name | 4-bromo-3-chlorophenol |
| SMILES | Oc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChIKey | FQEYHIPPYOSPLF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-3-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-chlorophenol?
The IUPAC name of 4-bromo-3-chlorophenol (CID 7018182) is 4-bromo-3-chlorophenol.
What is the SMILES notation for 4-bromo-3-chlorophenol?
The canonical SMILES for 4-bromo-3-chlorophenol is Oc1ccc(Br)c(Cl)c1.
What is the InChIKey of 4-bromo-3-chlorophenol?
The InChIKey is FQEYHIPPYOSPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H.
What are the key properties of 4-bromo-3-chlorophenol?
4-bromo-3-chlorophenol has a molecular weight of 207.45 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-chlorophenol is sourced from PubChem (CID 7018182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).