About tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate
tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate (PubChem CID 70181988) has the molecular formula C21H24N2O9
and a molecular weight of 448.43 g/mol. Its IUPAC name is tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate.
Molecular Properties
| Compound Name | tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate |
| PubChem CID | 70181988 |
| Molecular Formula | C21H24N2O9 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate |
| SMILES | COC(=O)C(=CO)Oc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H24N2O9/c1-21(2,3)32-19(26)17-12(30-14(11-24)18(25)29-6)8-7-9-13(17)31-20-22-15(27-4)10-16(23-20)28-5/h7-11,24H,1-6H3 |
| InChIKey | VJLRGEJFRCMRPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate?
The IUPAC name of tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate (CID 70181988) is tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate.
What is the SMILES notation for tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate?
The canonical SMILES for tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate is COC(=O)C(=CO)Oc1cccc(Oc2nc(OC)cc(OC)n2)c1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate?
The InChIKey is VJLRGEJFRCMRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O9/c1-21(2,3)32-19(26)17-12(30-14(11-24)18(25)29-6)8-7-9-13(17)31-20-22-15(27-4)10-16(23-20)28-5/h7-11,24H,1-6H3.
What are the key properties of tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate?
tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate has a molecular weight of 448.43 g/mol, XLogP of 3.19, 8 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-(1-hydroxy-3-methoxy-3-oxoprop-1-en-2-yl)oxybenzoate is sourced from PubChem (CID 70181988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).