About 2,2-diethylpiperidin-4-one
2,2-diethylpiperidin-4-one (PubChem CID 70182099) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,2-diethylpiperidin-4-one.
Molecular Properties
| Compound Name | 2,2-diethylpiperidin-4-one |
| PubChem CID | 70182099 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2,2-diethylpiperidin-4-one |
| SMILES | CCC1(CC)CC(=O)CCN1 |
| InChI | InChI=1S/C9H17NO/c1-3-9(4-2)7-8(11)5-6-10-9/h10H,3-7H2,1-2H3 |
| InChIKey | ZXCXHXKGIMOAEO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethylpiperidin-4-one?
The IUPAC name of 2,2-diethylpiperidin-4-one (CID 70182099) is 2,2-diethylpiperidin-4-one.
What is the SMILES notation for 2,2-diethylpiperidin-4-one?
The canonical SMILES for 2,2-diethylpiperidin-4-one is CCC1(CC)CC(=O)CCN1.
What is the InChIKey of 2,2-diethylpiperidin-4-one?
The InChIKey is ZXCXHXKGIMOAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-9(4-2)7-8(11)5-6-10-9/h10H,3-7H2,1-2H3.
What are the key properties of 2,2-diethylpiperidin-4-one?
2,2-diethylpiperidin-4-one has a molecular weight of 155.24 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethylpiperidin-4-one is sourced from PubChem (CID 70182099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).