C24H35NO3 — CID 70182118
(6Z,8S,9S,10R,13S,14S,17S)-17-acetyl-6-(1-aminoethoxymethylidene)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70182118) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (6Z,8S,9S,10R,13S,14S,17S)-17-acetyl-6-(1-aminoethoxymethylidene)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6Z,8S,9S,10R,13S,14S,17S)-17-acetyl-6-(1-aminoethoxymethylidene)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70182118 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (6Z,8S,9S,10R,13S,14S,17S)-17-acetyl-6-(1-aminoethoxymethylidene)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C/C(=C/OC(C)N)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H35NO3/c1-14(26)19-5-6-20-18-11-16(13-28-15(2)25)22-12-17(27)7-9-24(22,4)21(18)8-10-23(19,20)3/h12-13,15,18-21H,5-11,25H2,1-4H3/b16-13-/t15?,18-,19+,20-,21-,23+,24+/m0/s1 |
| InChIKey | LGACADBDBLDFBG-BEOFWBNPSA-N |
| XLogP | 4.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|