About 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid
6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid (PubChem CID 70182125) has the molecular formula C19H17FO6S
and a molecular weight of 392.40 g/mol. Its IUPAC name is 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid.
Molecular Properties
| Compound Name | 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid |
| PubChem CID | 70182125 |
| Molecular Formula | C19H17FO6S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid |
| SMILES | COC=C(Oc1ccc(F)c(CSc2ccccc2)c1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C19H17FO6S/c1-24-10-16(19(23)25-2)26-15-9-8-14(20)13(17(15)18(21)22)11-27-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | CECXWHGAPIWXMM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid?
The IUPAC name of 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid (CID 70182125) is 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid.
What is the SMILES notation for 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid?
The canonical SMILES for 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid is COC=C(Oc1ccc(F)c(CSc2ccccc2)c1C(=O)O)C(=O)OC.
What is the InChIKey of 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid?
The InChIKey is CECXWHGAPIWXMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FO6S/c1-24-10-16(19(23)25-2)26-15-9-8-14(20)13(17(15)18(21)22)11-27-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,21,22).
What are the key properties of 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid?
6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid has a molecular weight of 392.40 g/mol, XLogP of 3.86, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dimethoxy-3-oxoprop-1-en-2-yl)oxy-3-fluoro-2-(phenylsulfanylmethyl)benzoic acid is sourced from PubChem (CID 70182125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).