About 5,5-dimethyl-1,6-dihydroindole-4,7-dione
5,5-dimethyl-1,6-dihydroindole-4,7-dione (PubChem CID 70182304) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 5,5-dimethyl-1,6-dihydroindole-4,7-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-1,6-dihydroindole-4,7-dione |
| PubChem CID | 70182304 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5,5-dimethyl-1,6-dihydroindole-4,7-dione |
| SMILES | CC1(C)CC(=O)c2[nH]ccc2C1=O |
| InChI | InChI=1S/C10H11NO2/c1-10(2)5-7(12)8-6(9(10)13)3-4-11-8/h3-4,11H,5H2,1-2H3 |
| InChIKey | HNGIHRHCWLCJDC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-1,6-dihydroindole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1,6-dihydroindole-4,7-dione?
The IUPAC name of 5,5-dimethyl-1,6-dihydroindole-4,7-dione (CID 70182304) is 5,5-dimethyl-1,6-dihydroindole-4,7-dione.
What is the SMILES notation for 5,5-dimethyl-1,6-dihydroindole-4,7-dione?
The canonical SMILES for 5,5-dimethyl-1,6-dihydroindole-4,7-dione is CC1(C)CC(=O)c2[nH]ccc2C1=O.
What is the InChIKey of 5,5-dimethyl-1,6-dihydroindole-4,7-dione?
The InChIKey is HNGIHRHCWLCJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-10(2)5-7(12)8-6(9(10)13)3-4-11-8/h3-4,11H,5H2,1-2H3.
What are the key properties of 5,5-dimethyl-1,6-dihydroindole-4,7-dione?
5,5-dimethyl-1,6-dihydroindole-4,7-dione has a molecular weight of 177.20 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,6-dihydroindole-4,7-dione is sourced from PubChem (CID 70182304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).