About (2R)-2-isocyanatohexane
(2R)-2-isocyanatohexane (PubChem CID 7018267) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (2R)-2-isocyanatohexane.
Molecular Properties
| Compound Name | (2R)-2-isocyanatohexane |
| PubChem CID | 7018267 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2R)-2-isocyanatohexane |
| SMILES | CCCC[C@@H](C)N=C=O |
| InChI | InChI=1S/C7H13NO/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | JNWLFMYCGXLVJQ-SSDOTTSWSA-N |
| XLogP | 1.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-isocyanatohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-isocyanatohexane?
The IUPAC name of (2R)-2-isocyanatohexane (CID 7018267) is (2R)-2-isocyanatohexane.
What is the SMILES notation for (2R)-2-isocyanatohexane?
The canonical SMILES for (2R)-2-isocyanatohexane is CCCC[C@@H](C)N=C=O.
What is the InChIKey of (2R)-2-isocyanatohexane?
The InChIKey is JNWLFMYCGXLVJQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-2-isocyanatohexane?
(2R)-2-isocyanatohexane has a molecular weight of 127.19 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-isocyanatohexane is sourced from PubChem (CID 7018267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).