C13H20O6 — CID 70182816
1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]pentane-1,3-dione (PubChem CID 70182816) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]pentane-1,3-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]pentane-1,3-dione |
|---|---|
| PubChem CID | 70182816 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]pentane-1,3-dione |
| SMILES | CCC(=O)CC(=O)[C@@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H20O6/c1-5-7(14)6-8(15)9-10-11(12(16-4)17-9)19-13(2,3)18-10/h9-12H,5-6H2,1-4H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | UFEWDURJERDQAV-NNYUYHANSA-N |
| XLogP | 0.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|