C25H20O9 — CID 70182845
3'-hydroxy-6'-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 70182845) has the molecular formula C25H20O9 and a molecular weight of 464.43 g/mol. Its IUPAC name is 3'-hydroxy-6'-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-hydroxy-6'-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 70182845 |
| Molecular Formula | C25H20O9 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3'-hydroxy-6'-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O[C@@H]4OCC(O)[C@H](O)[C@H]4O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C25H20O9/c26-12-5-7-16-19(9-12)33-20-10-13(32-24-22(29)21(28)18(27)11-31-24)6-8-17(20)25(16)15-4-2-1-3-14(15)23(30)34-25/h1-10,18,21-22,24,26-29H,11H2/t18?,21-,22+,24-,25?/m0/s1 |
| InChIKey | SEIBGLWZTUKJNJ-HFEQNLFFSA-N |
| XLogP | 1.78 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |