About 1,3-dihydroindol-2-one;imidazolidin-2-one
1,3-dihydroindol-2-one;imidazolidin-2-one (PubChem CID 70182850) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;imidazolidin-2-one.
Molecular Properties
| Compound Name | 1,3-dihydroindol-2-one;imidazolidin-2-one |
| PubChem CID | 70182850 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1,3-dihydroindol-2-one;imidazolidin-2-one |
| SMILES | O=C1Cc2ccccc2N1.O=C1NCCN1 |
| InChI | InChI=1S/C8H7NO.C3H6N2O/c10-8-5-6-3-1-2-4-7(6)9-8;6-3-4-1-2-5-3/h1-4H,5H2,(H,9,10);1-2H2,(H2,4,5,6) |
| InChIKey | ZWRUUAWQUGBMBY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dihydroindol-2-one;imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroindol-2-one;imidazolidin-2-one?
The IUPAC name of 1,3-dihydroindol-2-one;imidazolidin-2-one (CID 70182850) is 1,3-dihydroindol-2-one;imidazolidin-2-one.
What is the SMILES notation for 1,3-dihydroindol-2-one;imidazolidin-2-one?
The canonical SMILES for 1,3-dihydroindol-2-one;imidazolidin-2-one is O=C1Cc2ccccc2N1.O=C1NCCN1.
What is the InChIKey of 1,3-dihydroindol-2-one;imidazolidin-2-one?
The InChIKey is ZWRUUAWQUGBMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C3H6N2O/c10-8-5-6-3-1-2-4-7(6)9-8;6-3-4-1-2-5-3/h1-4H,5H2,(H,9,10);1-2H2,(H2,4,5,6).
What are the key properties of 1,3-dihydroindol-2-one;imidazolidin-2-one?
1,3-dihydroindol-2-one;imidazolidin-2-one has a molecular weight of 219.24 g/mol, XLogP of 0.48, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroindol-2-one;imidazolidin-2-one is sourced from PubChem (CID 70182850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).