C24H28N4O2 — CID 70183155
2-(1H-imidazol-5-ylmethyl)-N,N'-bis(2-phenylethyl)butanediamide (PubChem CID 70183155) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-(1H-imidazol-5-ylmethyl)-N,N'-bis(2-phenylethyl)butanediamide.
| Compound Name | 2-(1H-imidazol-5-ylmethyl)-N,N'-bis(2-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 70183155 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-(1H-imidazol-5-ylmethyl)-N,N'-bis(2-phenylethyl)butanediamide |
| SMILES | O=C(CC(Cc1cnc[nH]1)C(=O)NCCc1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H28N4O2/c29-23(26-13-11-19-7-3-1-4-8-19)16-21(15-22-17-25-18-28-22)24(30)27-14-12-20-9-5-2-6-10-20/h1-10,17-18,21H,11-16H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | GSQZHTWMGXXCGP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |