About 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid
3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid (PubChem CID 70183398) has the molecular formula C18H26O5
and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid |
| PubChem CID | 70183398 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)c1cc(C(O)OC(=O)CC(=O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26O5/c1-17(2,3)12-7-11(8-13(9-12)18(4,5)6)16(22)23-15(21)10-14(19)20/h7-9,16,22H,10H2,1-6H3,(H,19,20) |
| InChIKey | MQWRWBCRXPGWMF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid?
The IUPAC name of 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid (CID 70183398) is 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid.
What is the SMILES notation for 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid?
The canonical SMILES for 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid is CC(C)(C)c1cc(C(O)OC(=O)CC(=O)O)cc(C(C)(C)C)c1.
What is the InChIKey of 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid?
The InChIKey is MQWRWBCRXPGWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O5/c1-17(2,3)12-7-11(8-13(9-12)18(4,5)6)16(22)23-15(21)10-14(19)20/h7-9,16,22H,10H2,1-6H3,(H,19,20).
What are the key properties of 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid?
3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid has a molecular weight of 322.40 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-ditert-butylphenyl)-hydroxymethoxy]-3-oxopropanoic acid is sourced from PubChem (CID 70183398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).