C27H32O2 — CID 70183438
ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoate (PubChem CID 70183438) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70183438 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | ethyl 3-[3-[1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]prop-2-enoate |
| SMILES | C=C(c1cccc(C=CC(=O)OCC)c1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H32O2/c1-7-29-25(28)14-11-20-9-8-10-21(17-20)19(2)22-12-13-23-24(18-22)27(5,6)16-15-26(23,3)4/h8-14,17-18H,2,7,15-16H2,1,3-6H3 |
| InChIKey | RRTLOBRYEPWOBP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|